CAS 1248566-00-8 is the registry number for 3,3,7-Trimethyl-2-oxoindoline-5-sulfonyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3,3,7-trimethyl-2-oxo-1H-indole-5-sulfonyl chloride (CAS 1248566-00-8) is a chemical compound with the molecular formula C11H12ClNO3S and a molecular weight of 273.74 g/mol. IUPAC name: 3,3,7-trimethyl-2-oxo-1H-indole-5-sulfonyl chloride. InChIKey: CIRPPRNKKBGRBE-UHFFFAOYSA-N.
| Molecular formula | C11H12ClNO3S |
|---|---|
| Molecular weight | 273.74 g/mol |
| IUPAC name | 3,3,7-trimethyl-2-oxo-1H-indole-5-sulfonyl chloride |
| InChIKey | CIRPPRNKKBGRBE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC2=C1NC(=O)C2(C)C)S(=O)(=O)Cl |
Computed by PubChem (NCBI)