Products 878433-23-9

CAS 878433-23-9 appears in our catalog under these names: 2-Methyl-5-(2-oxo-pyrrolidin-1-yl)-benzenesulfonyl chloride, 95%, 2-Methyl-5-(2-oxopyrrolidin-1-yl)benzene-1-sulfonyl chloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

2-methyl-5-(2-oxopyrrolidin-1-yl)benzenesulfonyl chloride (CAS 878433-23-9) is a chemical compound with the molecular formula C11H12ClNO3S and a molecular weight of 273.74 g/mol. IUPAC name: 2-methyl-5-(2-oxopyrrolidin-1-yl)benzenesulfonyl chloride. InChIKey: BWTNVYNSLQCXRC-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12ClNO3S
Molecular weight273.74 g/mol
IUPAC name2-methyl-5-(2-oxopyrrolidin-1-yl)benzenesulfonyl chloride
InChIKeyBWTNVYNSLQCXRC-UHFFFAOYSA-N
SMILESCC1=C(C=C(C=C1)N2CCCC2=O)S(=O)(=O)Cl

Computed by PubChem (NCBI)