Products 105424-75-7
CAS 105424-75-7 appears in our catalog under these names: (S)-Methyl 1-tosylaziridine-2-carboxylate, 95%, (S)–methyl 1–tosylaziridine–2–carboxylate. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
Methyl (2S)-1-(4-methylphenyl)sulfonylaziridine-2-carboxylate (CAS 105424-75-7) is a chemical compound with the molecular formula C11H13NO4S and a molecular weight of 255.29 g/mol. IUPAC name: methyl (2S)-1-(4-methylphenyl)sulfonylaziridine-2-carboxylate. InChIKey: XVHSPJDUTHOVFO-NUHJPDEHSA-N.
| Molecular formula | C11H13NO4S |
|---|---|
| Molecular weight | 255.29 g/mol |
| IUPAC name | methyl (2S)-1-(4-methylphenyl)sulfonylaziridine-2-carboxylate |
| InChIKey | XVHSPJDUTHOVFO-NUHJPDEHSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2C[C@H]2C(=O)OC |
Computed by PubChem (NCBI)