CAS 105456-67-5 is the registry number for Vortioxetine Impurity 82. Offered by: Chemat Brand. Available pack sizes: on request.
2,4-dimethyl-1-(4-nitrophenyl)sulfanylbenzene (CAS 105456-67-5) is a chemical compound with the molecular formula C14H13NO2S and a molecular weight of 259.33 g/mol. IUPAC name: 2,4-dimethyl-1-(4-nitrophenyl)sulfanylbenzene. InChIKey: XRIHCIZAMLPEOT-UHFFFAOYSA-N.
| Molecular formula | C14H13NO2S |
|---|---|
| Molecular weight | 259.33 g/mol |
| IUPAC name | 2,4-dimethyl-1-(4-nitrophenyl)sulfanylbenzene |
| InChIKey | XRIHCIZAMLPEOT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)SC2=CC=C(C=C2)[N+](=O)[O-])C |
Computed by PubChem (NCBI)