CAS 10553-17-0 is the registry number for N-(4-Methoxyphenyl)-4-nitrobenzenesulfonamide, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 10g, 25g, 50g, 100g, 200g.
N-(4-methoxyphenyl)-4-nitrobenzenesulfonamide (CAS 10553-17-0) is a chemical compound with the molecular formula C13H12N2O5S and a molecular weight of 308.31 g/mol. IUPAC name: N-(4-methoxyphenyl)-4-nitrobenzenesulfonamide. InChIKey: PGNXXIOBJLPXFL-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O5S |
|---|---|
| Molecular weight | 308.31 g/mol |
| IUPAC name | N-(4-methoxyphenyl)-4-nitrobenzenesulfonamide |
| InChIKey | PGNXXIOBJLPXFL-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)NS(=O)(=O)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)