CAS 28328-54-3 appears in our catalog under these names: 3-Amino-4-phenoxy-5-sulfamoylbenzoic Acid, 3-Amino-4-phenoxy-5-sulfamoylbenzoic acid, 95+%, Bumetanide EP Impurity B, Bumetanide Impurity 2 (Bumetanide EP Impurity B), Desbutyl Bumetanide, >95% (HPLC). Offered by: Mikromol, Chemat Brand, Hubei YoungXin, TRC, Ambeed. Available pack sizes: 25mg, 100mg, on request, 10mg, 50mg, 200mg, 250mg, 1g.
3-amino-4-phenoxy-5-sulfamoylbenzoic acid (CAS 28328-54-3) is a chemical compound with the molecular formula C13H12N2O5S and a molecular weight of 308.31 g/mol. IUPAC name: 3-amino-4-phenoxy-5-sulfamoylbenzoic acid. InChIKey: GVQZPZSQRCXSJI-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O5S |
|---|---|
| Molecular weight | 308.31 g/mol |
| IUPAC name | 3-amino-4-phenoxy-5-sulfamoylbenzoic acid |
| InChIKey | GVQZPZSQRCXSJI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=C(C=C(C=C2S(=O)(=O)N)C(=O)O)N |
Computed by PubChem (NCBI)