Products 1330180-22-7
CAS 1330180-22-7 appears in our catalog under these names: Nimesulide-d5, Nimesulide-d5, >95% (HPLC), Nimesulide D5, Nimesulide D5. Offered by: Chemat Brand, TRC, TargetMol, GLPBio, Biosynth. Available pack sizes: on request, 2,5mg, 25mg, 1mg, 10mg, 5mg, 50mg, 1 mg.
N-[4-nitro-2-(2,3,4,5,6-pentadeuteriophenoxy)phenyl]methanesulfonamide (CAS 1330180-22-7) is a chemical compound with the molecular formula C13H12N2O5S and a molecular weight of 313.34 g/mol. IUPAC name: N-[4-nitro-2-(2,3,4,5,6-pentadeuteriophenoxy)phenyl]methanesulfonamide. InChIKey: HYWYRSMBCFDLJT-VIQYUKPQSA-N.
| Molecular formula | C13H12N2O5S |
|---|---|
| Molecular weight | 313.34 g/mol |
| IUPAC name | N-[4-nitro-2-(2,3,4,5,6-pentadeuteriophenoxy)phenyl]methanesulfonamide |
| InChIKey | HYWYRSMBCFDLJT-VIQYUKPQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])OC2=C(C=CC(=C2)[N+](=O)[O-])NS(=O)(=O)C)[2H])[2H] |
Computed by PubChem (NCBI)