CAS 2171334-50-0 is the registry number for 4-Nitrobenzyl 3-oxo-2-thia-5-azabicyclo[2.2.1]heptane-5-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(4-nitrophenyl)methyl 3-oxo-2-thia-5-azabicyclo[2.2.1]heptane-5-carboxylate (CAS 2171334-50-0) is a chemical compound with the molecular formula C13H12N2O5S and a molecular weight of 308.31 g/mol. IUPAC name: (4-nitrophenyl)methyl 3-oxo-2-thia-5-azabicyclo[2.2.1]heptane-5-carboxylate. InChIKey: UCDOMXQZYYKAEQ-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O5S |
|---|---|
| Molecular weight | 308.31 g/mol |
| IUPAC name | (4-nitrophenyl)methyl 3-oxo-2-thia-5-azabicyclo[2.2.1]heptane-5-carboxylate |
| InChIKey | UCDOMXQZYYKAEQ-UHFFFAOYSA-N |
| SMILES | C1C2CN(C1C(=O)S2)C(=O)OCC3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)