CAS 91-35-0 appears in our catalog under these names: 2-[[(3-Amino-4-hydroxyphenyl)sulphonyl]amino]benzoic acid, 98%, 2-(3-Amino-4-hydroxyphenylsulfonamido)benzoic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 25g.
2-[(3-amino-4-hydroxyphenyl)sulfonylamino]benzoic acid (CAS 91-35-0) is a chemical compound with the molecular formula C13H12N2O5S and a molecular weight of 308.31 g/mol. IUPAC name: 2-[(3-amino-4-hydroxyphenyl)sulfonylamino]benzoic acid. InChIKey: ISDVREGLMJJFJG-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O5S |
|---|---|
| Molecular weight | 308.31 g/mol |
| IUPAC name | 2-[(3-amino-4-hydroxyphenyl)sulfonylamino]benzoic acid |
| InChIKey | ISDVREGLMJJFJG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)NS(=O)(=O)C2=CC(=C(C=C2)O)N |
Computed by PubChem (NCBI)