Products 105576-79-2

CAS 105576-79-2 is the registry number for 2-(1-Methyl-4-oxo-1,4-dihydroquinolin-3-yl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

2-(1-methyl-4-oxoquinolin-3-yl)benzoic acid (CAS 105576-79-2) is a chemical compound with the molecular formula C17H13NO3 and a molecular weight of 279.29 g/mol. IUPAC name: 2-(1-methyl-4-oxoquinolin-3-yl)benzoic acid. InChIKey: WEFLANDBXLRUSP-UHFFFAOYSA-N.

Identity
Molecular formulaC17H13NO3
Molecular weight279.29 g/mol
IUPAC name2-(1-methyl-4-oxoquinolin-3-yl)benzoic acid
InChIKeyWEFLANDBXLRUSP-UHFFFAOYSA-N
SMILESCN1C=C(C(=O)C2=CC=CC=C21)C3=CC=CC=C3C(=O)O

Computed by PubChem (NCBI)