CAS 32795-58-7 appears in our catalog under these names: 6-Methoxy-2-phenyl-quinoline-4-carboxylic acid, 95%, 6-Methoxy-2-phenyl-quinoline-4-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
6-methoxy-2-phenylquinoline-4-carboxylic acid (CAS 32795-58-7) is a chemical compound with the molecular formula C17H13NO3 and a molecular weight of 279.29 g/mol. IUPAC name: 6-methoxy-2-phenylquinoline-4-carboxylic acid. InChIKey: AMQMKQXMOAQMSJ-UHFFFAOYSA-N.
| Molecular formula | C17H13NO3 |
|---|---|
| Molecular weight | 279.29 g/mol |
| IUPAC name | 6-methoxy-2-phenylquinoline-4-carboxylic acid |
| InChIKey | AMQMKQXMOAQMSJ-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)N=C(C=C2C(=O)O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)