CAS 105653-00-7 is the registry number for Pregabalin Impurity 88. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2-hydroxy-2-phenylacetyl)oxy-2-phenylacetic acid (CAS 105653-00-7) is a chemical compound with the molecular formula C16H14O5 and a molecular weight of 286.28 g/mol. IUPAC name: 2-(2-hydroxy-2-phenylacetyl)oxy-2-phenylacetic acid. InChIKey: RASCAYGBSQKNNI-UHFFFAOYSA-N.
| Molecular formula | C16H14O5 |
|---|---|
| Molecular weight | 286.28 g/mol |
| IUPAC name | 2-(2-hydroxy-2-phenylacetyl)oxy-2-phenylacetic acid |
| InChIKey | RASCAYGBSQKNNI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C(=O)OC(C2=CC=CC=C2)C(=O)O)O |
Computed by PubChem (NCBI)