Products 105653-00-7

CAS 105653-00-7 is the registry number for Pregabalin Impurity 88. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-(2-hydroxy-2-phenylacetyl)oxy-2-phenylacetic acid (CAS 105653-00-7) is a chemical compound with the molecular formula C16H14O5 and a molecular weight of 286.28 g/mol. IUPAC name: 2-(2-hydroxy-2-phenylacetyl)oxy-2-phenylacetic acid. InChIKey: RASCAYGBSQKNNI-UHFFFAOYSA-N.

Identity
Molecular formulaC16H14O5
Molecular weight286.28 g/mol
IUPAC name2-(2-hydroxy-2-phenylacetyl)oxy-2-phenylacetic acid
InChIKeyRASCAYGBSQKNNI-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C(C(=O)OC(C2=CC=CC=C2)C(=O)O)O

Computed by PubChem (NCBI)