CAS 1056557-90-4 is the registry number for Methyl 2-(2-bromobenzo(d)thiazol-6-yl)acetate, 97%. Offered by: AmBeed. Available pack sizes: 5g.
Methyl 2-(2-bromo-1,3-benzothiazol-6-yl)acetate (CAS 1056557-90-4) is a chemical compound with the molecular formula C10H8BrNO2S and a molecular weight of 286.15 g/mol. IUPAC name: methyl 2-(2-bromo-1,3-benzothiazol-6-yl)acetate. InChIKey: UMKIOMAKUZUSTI-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO2S |
|---|---|
| Molecular weight | 286.15 g/mol |
| IUPAC name | methyl 2-(2-bromo-1,3-benzothiazol-6-yl)acetate |
| InChIKey | UMKIOMAKUZUSTI-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=CC2=C(C=C1)N=C(S2)Br |
Computed by PubChem (NCBI)