CAS 1056639-87-2 is the registry number for 2-(Chloromethyl)-6-methoxy-1,3-benzothiazole. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(chloromethyl)-6-methoxy-1,3-benzothiazole (CAS 1056639-87-2) is a chemical compound with the molecular formula C9H8ClNOS and a molecular weight of 213.68 g/mol. IUPAC name: 2-(chloromethyl)-6-methoxy-1,3-benzothiazole. InChIKey: UNJWZSNILZUIOZ-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNOS |
|---|---|
| Molecular weight | 213.68 g/mol |
| IUPAC name | 2-(chloromethyl)-6-methoxy-1,3-benzothiazole |
| InChIKey | UNJWZSNILZUIOZ-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)N=C(S2)CCl |
Computed by PubChem (NCBI)