CAS 110766-84-2 is the registry number for 8-Chloro-2,3,4,5-tetrahydro-1,5-benzothiazepin-4-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
8-chloro-3,5-dihydro-2H-1,5-benzothiazepin-4-one (CAS 110766-84-2) is a chemical compound with the molecular formula C9H8ClNOS and a molecular weight of 213.68 g/mol. IUPAC name: 8-chloro-3,5-dihydro-2H-1,5-benzothiazepin-4-one. InChIKey: WYWKPNIAGOEYTD-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNOS |
|---|---|
| Molecular weight | 213.68 g/mol |
| IUPAC name | 8-chloro-3,5-dihydro-2H-1,5-benzothiazepin-4-one |
| InChIKey | WYWKPNIAGOEYTD-UHFFFAOYSA-N |
| SMILES | C1CSC2=C(C=CC(=C2)Cl)NC1=O |
Computed by PubChem (NCBI)