Products 1057279-92-1

CAS 1057279-92-1 is the registry number for 2-(2-Chlorophenyl)-1,2,3,4-tetrahydroisoquinoline, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

2-(2-chlorophenyl)-3,4-dihydro-1H-isoquinoline (CAS 1057279-92-1) is a chemical compound with the molecular formula C15H14ClN and a molecular weight of 243.73 g/mol. IUPAC name: 2-(2-chlorophenyl)-3,4-dihydro-1H-isoquinoline. InChIKey: CZLJGPMPYCSSME-UHFFFAOYSA-N.

Identity
Molecular formulaC15H14ClN
Molecular weight243.73 g/mol
IUPAC name2-(2-chlorophenyl)-3,4-dihydro-1H-isoquinoline
InChIKeyCZLJGPMPYCSSME-UHFFFAOYSA-N
SMILESC1CN(CC2=CC=CC=C21)C3=CC=CC=C3Cl

Computed by PubChem (NCBI)