Products 33237-87-5
CAS 33237-87-5 is the registry number for N-(4-Chlorophenyl)-2,3-dihydro-1h-inden-2-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
N-(4-chlorophenyl)-2,3-dihydro-1H-inden-2-amine (CAS 33237-87-5) is a chemical compound with the molecular formula C15H14ClN and a molecular weight of 243.73 g/mol. IUPAC name: N-(4-chlorophenyl)-2,3-dihydro-1H-inden-2-amine. InChIKey: FFDVWQRDZXROAN-UHFFFAOYSA-N.
| Molecular formula | C15H14ClN |
|---|---|
| Molecular weight | 243.73 g/mol |
| IUPAC name | N-(4-chlorophenyl)-2,3-dihydro-1H-inden-2-amine |
| InChIKey | FFDVWQRDZXROAN-UHFFFAOYSA-N |
| SMILES | C1C(CC2=CC=CC=C21)NC3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)