CAS 78317-78-9 appears in our catalog under these names: 2-(4-Chlorophenyl)-1,2,3,4-tetrahydroisoquinoline, 95%, 95%, 2-(4-Chlorophenyl)-1,2,3,4-tetrahydroisoquinoline, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
2-(4-chlorophenyl)-3,4-dihydro-1H-isoquinoline (CAS 78317-78-9) is a chemical compound with the molecular formula C15H14ClN and a molecular weight of 243.73 g/mol. IUPAC name: 2-(4-chlorophenyl)-3,4-dihydro-1H-isoquinoline. InChIKey: BQYNICOEUCGJHA-UHFFFAOYSA-N.
| Molecular formula | C15H14ClN |
|---|---|
| Molecular weight | 243.73 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-3,4-dihydro-1H-isoquinoline |
| InChIKey | BQYNICOEUCGJHA-UHFFFAOYSA-N |
| SMILES | C1CN(CC2=CC=CC=C21)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)