CAS 18004-58-5 appears in our catalog under these names: 9-Anthracenemethanamine, hydrochloride (1:1), 95%, 95%, C-ANTHRACEN-9-YL-METHYLAMINE HYDROCHLORIDE, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
Anthracen-9-ylmethanamine;hydrochloride (CAS 18004-58-5) is a chemical compound with the molecular formula C15H14ClN and a molecular weight of 243.73 g/mol. IUPAC name: anthracen-9-ylmethanamine;hydrochloride. InChIKey: WYAPSIOWXSDTNS-UHFFFAOYSA-N.
| Molecular formula | C15H14ClN |
|---|---|
| Molecular weight | 243.73 g/mol |
| IUPAC name | anthracen-9-ylmethanamine;hydrochloride |
| InChIKey | WYAPSIOWXSDTNS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C3C=CC=CC3=C2CN.Cl |
Computed by PubChem (NCBI)