CAS 2448293-73-8 is the registry number for 4-Chloro-1-(3,3-dimethylbut-1-yn-1-yl)isoquinoline, 97%. Offered by: AmBeed. Available pack sizes: 1g.
4-chloro-1-(3,3-dimethylbut-1-ynyl)isoquinoline (CAS 2448293-73-8) is a chemical compound with the molecular formula C15H14ClN and a molecular weight of 243.73 g/mol. IUPAC name: 4-chloro-1-(3,3-dimethylbut-1-ynyl)isoquinoline. InChIKey: XAORWDFJYYXHLQ-UHFFFAOYSA-N.
| Molecular formula | C15H14ClN |
|---|---|
| Molecular weight | 243.73 g/mol |
| IUPAC name | 4-chloro-1-(3,3-dimethylbut-1-ynyl)isoquinoline |
| InChIKey | XAORWDFJYYXHLQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C#CC1=NC=C(C2=CC=CC=C21)Cl |
Computed by PubChem (NCBI)