Products 105728-06-1
CAS 105728-06-1 appears in our catalog under these names: (3-Formyl-4-nitrophenoxy)acetic acid, 95%, 2–(3–formyl–4–nitrophenoxy)acetic acid, 2-(3-Formyl-4-nitrophenoxy)acetic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 100mg, 250mg, 25mg, 50mg.
2-(3-formyl-4-nitrophenoxy)acetic acid (CAS 105728-06-1) is a chemical compound with the molecular formula C9H7NO6 and a molecular weight of 225.15 g/mol. IUPAC name: 2-(3-formyl-4-nitrophenoxy)acetic acid. InChIKey: LNLRSVVPVPSANB-UHFFFAOYSA-N.
| Molecular formula | C9H7NO6 |
|---|---|
| Molecular weight | 225.15 g/mol |
| IUPAC name | 2-(3-formyl-4-nitrophenoxy)acetic acid |
| InChIKey | LNLRSVVPVPSANB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OCC(=O)O)C=O)[N+](=O)[O-] |
Computed by PubChem (NCBI)