Products 17336-14-0
CAS 17336-14-0 appears in our catalog under these names: 2-(Acetyloxy)-5-nitrobenzoic acid, 95%, 2-Acetoxy-5-nitrobenzoic acid, 95%, 2–Acetoxy–5–nitrobenzoic acid. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 25g, 5g, 100g.
2-acetyloxy-5-nitrobenzoic acid (CAS 17336-14-0) is a chemical compound with the molecular formula C9H7NO6 and a molecular weight of 225.15 g/mol. IUPAC name: 2-acetyloxy-5-nitrobenzoic acid. InChIKey: GLNHSJMDXOHYPL-UHFFFAOYSA-N.
| Molecular formula | C9H7NO6 |
|---|---|
| Molecular weight | 225.15 g/mol |
| IUPAC name | 2-acetyloxy-5-nitrobenzoic acid |
| InChIKey | GLNHSJMDXOHYPL-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=C(C=C(C=C1)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)