Products 412284-26-5
CAS 412284-26-5 is the registry number for 3-(5-Hydroxy-2-nitrophenyl)-2-oxopropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(5-hydroxy-2-nitrophenyl)-2-oxopropanoic acid (CAS 412284-26-5) is a chemical compound with the molecular formula C9H7NO6 and a molecular weight of 225.15 g/mol. IUPAC name: 3-(5-hydroxy-2-nitrophenyl)-2-oxopropanoic acid. InChIKey: JCDOSVKGOPRAKD-UHFFFAOYSA-N.
| Molecular formula | C9H7NO6 |
|---|---|
| Molecular weight | 225.15 g/mol |
| IUPAC name | 3-(5-hydroxy-2-nitrophenyl)-2-oxopropanoic acid |
| InChIKey | JCDOSVKGOPRAKD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)CC(=O)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)