Products 444667-11-2
CAS 444667-11-2 appears in our catalog under these names: 4-(Carboxymethyl)-3-nitrobenzoic acid, 96%, Nintedanib Impurity 51, 4-(Carboxymethyl)-3-nitrobenzoic acid, 98%. Offered by: Combi-blocks, Chemat Brand, AmBeed. Available pack sizes: 1g, 25g, 10g, 5g, on request, 250mg.
4-(carboxymethyl)-3-nitrobenzoic acid (CAS 444667-11-2) is a chemical compound with the molecular formula C9H7NO6 and a molecular weight of 225.15 g/mol. IUPAC name: 4-(carboxymethyl)-3-nitrobenzoic acid. InChIKey: IKQGHWIOQHURNN-UHFFFAOYSA-N.
| Molecular formula | C9H7NO6 |
|---|---|
| Molecular weight | 225.15 g/mol |
| IUPAC name | 4-(carboxymethyl)-3-nitrobenzoic acid |
| InChIKey | IKQGHWIOQHURNN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)[N+](=O)[O-])CC(=O)O |
Computed by PubChem (NCBI)