CAS 7107-08-6 appears in our catalog under these names: 6-Nitro-1,3-benzodioxol-5-yl acetate, 95%, 6-Nitrobenzo(d)(1,3)dioxol-5-yl acetate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
(6-nitro-1,3-benzodioxol-5-yl) acetate (CAS 7107-08-6) is a chemical compound with the molecular formula C9H7NO6 and a molecular weight of 225.15 g/mol. IUPAC name: (6-nitro-1,3-benzodioxol-5-yl) acetate. InChIKey: DECGMUJJYLXRPA-UHFFFAOYSA-N.
| Molecular formula | C9H7NO6 |
|---|---|
| Molecular weight | 225.15 g/mol |
| IUPAC name | (6-nitro-1,3-benzodioxol-5-yl) acetate |
| InChIKey | DECGMUJJYLXRPA-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC2=C(C=C1[N+](=O)[O-])OCO2 |
Computed by PubChem (NCBI)