CAS 105799-73-3 is the registry number for 6-Fluoro-2,3-dihydro-2,2-dimethylchromen-4-one. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
6-fluoro-2,2-dimethyl-3H-chromen-4-one (CAS 105799-73-3) is a chemical compound with the molecular formula C11H11FO2 and a molecular weight of 194.20 g/mol. IUPAC name: 6-fluoro-2,2-dimethyl-3H-chromen-4-one. InChIKey: MPJMDEXLUJRBBJ-UHFFFAOYSA-N.
| Molecular formula | C11H11FO2 |
|---|---|
| Molecular weight | 194.20 g/mol |
| IUPAC name | 6-fluoro-2,2-dimethyl-3H-chromen-4-one |
| InChIKey | MPJMDEXLUJRBBJ-UHFFFAOYSA-N |
| SMILES | CC1(CC(=O)C2=C(O1)C=CC(=C2)F)C |
Computed by PubChem (NCBI)