CAS 1060815-92-0 is the registry number for 4-Chloro-5-iodo-2-methyl-7h-pyrrolo[2,3-d]pyrimidine, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
4-chloro-5-iodo-2-methyl-7H-pyrrolo[2,3-d]pyrimidine (CAS 1060815-92-0) is a chemical compound with the molecular formula C7H5ClIN3 and a molecular weight of 293.49 g/mol. IUPAC name: 4-chloro-5-iodo-2-methyl-7H-pyrrolo[2,3-d]pyrimidine. InChIKey: PLKRSMDMXVKCAM-UHFFFAOYSA-N.
| Molecular formula | C7H5ClIN3 |
|---|---|
| Molecular weight | 293.49 g/mol |
| IUPAC name | 4-chloro-5-iodo-2-methyl-7H-pyrrolo[2,3-d]pyrimidine |
| InChIKey | PLKRSMDMXVKCAM-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C(=CN2)I)C(=N1)Cl |
Computed by PubChem (NCBI)