CAS 1638763-64-0 appears in our catalog under these names: 2-Chloro-6-iodo-7-methyl-7h-pyrrolo[2,3-d]pyrimidine, 95%, 2-Chloro-6-iodo-7-methyl-7H-pyrrolo(2,3-d)pyrimidine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 100mg, 5g, 1g.
2-chloro-6-iodo-7-methylpyrrolo[2,3-d]pyrimidine (CAS 1638763-64-0) is a chemical compound with the molecular formula C7H5ClIN3 and a molecular weight of 293.49 g/mol. IUPAC name: 2-chloro-6-iodo-7-methylpyrrolo[2,3-d]pyrimidine. InChIKey: KUBITAMYGQVJHN-UHFFFAOYSA-N.
| Molecular formula | C7H5ClIN3 |
|---|---|
| Molecular weight | 293.49 g/mol |
| IUPAC name | 2-chloro-6-iodo-7-methylpyrrolo[2,3-d]pyrimidine |
| InChIKey | KUBITAMYGQVJHN-UHFFFAOYSA-N |
| SMILES | CN1C(=CC2=CN=C(N=C21)Cl)I |
Computed by PubChem (NCBI)