CAS 1638760-71-0 appears in our catalog under these names: 2-Chloro-5-iodo-7-methyl-7h-pyrrolo[2,3-d]pyrimidine, 95%, 2-Chloro-5-iodo-7-methyl-7H-pyrrolo(2,3-d)pyrimidine, 98%, 2-Chloro-5-iodo-7-methyl-7H-pyrrolo(2,3-d)pyrimidine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 1g, 2,5g.
2-chloro-5-iodo-7-methylpyrrolo[2,3-d]pyrimidine (CAS 1638760-71-0) is a chemical compound with the molecular formula C7H5ClIN3 and a molecular weight of 293.49 g/mol. IUPAC name: 2-chloro-5-iodo-7-methylpyrrolo[2,3-d]pyrimidine. InChIKey: LNEQRDAJABDGLP-UHFFFAOYSA-N.
| Molecular formula | C7H5ClIN3 |
|---|---|
| Molecular weight | 293.49 g/mol |
| IUPAC name | 2-chloro-5-iodo-7-methylpyrrolo[2,3-d]pyrimidine |
| InChIKey | LNEQRDAJABDGLP-UHFFFAOYSA-N |
| SMILES | CN1C=C(C2=CN=C(N=C21)Cl)I |
Computed by PubChem (NCBI)