CAS 1152475-62-1 appears in our catalog under these names: 2-Chloro-7-iodo-5-methyl-5H-pyrrolo[3,2-d]pyrimidine, 95%, 2-Chloro-7-iodo-5-methyl-5H-pyrrolo[3,2-d]pyrimidine 98%, 2-Chloro-7-iodo-5-methyl-5H-pyrrolo[3,2-d]pyrimidine, 98%, 98%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 100mg.
2-chloro-7-iodo-5-methylpyrrolo[3,2-d]pyrimidine (CAS 1152475-62-1) is a chemical compound with the molecular formula C7H5ClIN3 and a molecular weight of 293.49 g/mol. IUPAC name: 2-chloro-7-iodo-5-methylpyrrolo[3,2-d]pyrimidine. InChIKey: ZSWFSJYDYCROCL-UHFFFAOYSA-N.
| Molecular formula | C7H5ClIN3 |
|---|---|
| Molecular weight | 293.49 g/mol |
| IUPAC name | 2-chloro-7-iodo-5-methylpyrrolo[3,2-d]pyrimidine |
| InChIKey | ZSWFSJYDYCROCL-UHFFFAOYSA-N |
| SMILES | CN1C=C(C2=NC(=NC=C21)Cl)I |
Computed by PubChem (NCBI)