CAS 2766312-13-2 is the registry number for 6-Chloro-3-iodo-1-methyl-1H-pyrazolo[4,3-c]pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-chloro-3-iodo-1-methylpyrazolo[4,3-c]pyridine (CAS 2766312-13-2) is a chemical compound with the molecular formula C7H5ClIN3 and a molecular weight of 293.49 g/mol. IUPAC name: 6-chloro-3-iodo-1-methylpyrazolo[4,3-c]pyridine. InChIKey: JTFVMPHGJBSCCW-UHFFFAOYSA-N.
| Molecular formula | C7H5ClIN3 |
|---|---|
| Molecular weight | 293.49 g/mol |
| IUPAC name | 6-chloro-3-iodo-1-methylpyrazolo[4,3-c]pyridine |
| InChIKey | JTFVMPHGJBSCCW-UHFFFAOYSA-N |
| SMILES | CN1C2=CC(=NC=C2C(=N1)I)Cl |
Computed by PubChem (NCBI)