CAS 1060980-59-7 appears in our catalog under these names: 6-Fluoro-2-methyl-2,3,4,5-tetrahydro-1h-pyrido[4,3-b]indole, 95%, 6-Fluoro-2-methyl-2,3,4,5-tetrahydro-1H-pyrido(4,3-b)indole, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
6-fluoro-2-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indole (CAS 1060980-59-7) is a chemical compound with the molecular formula C12H13FN2 and a molecular weight of 204.24 g/mol. IUPAC name: 6-fluoro-2-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indole. InChIKey: FVEVVXZRMUMEOX-UHFFFAOYSA-N.
| Molecular formula | C12H13FN2 |
|---|---|
| Molecular weight | 204.24 g/mol |
| IUPAC name | 6-fluoro-2-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indole |
| InChIKey | FVEVVXZRMUMEOX-UHFFFAOYSA-N |
| SMILES | CN1CCC2=C(C1)C3=C(N2)C(=CC=C3)F |
Computed by PubChem (NCBI)