Products 1429901-83-6
CAS 1429901-83-6 appears in our catalog under these names: 6-Fluoro-2,3,4,9-tetrahydro-1h-carbazol-1-amine, 95%, 6-Fluoro-2,3,4,9-tetrahydro-1H-carbazol-1-amine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 5g, 0,5g.
6-fluoro-2,3,4,9-tetrahydro-1H-carbazol-1-amine (CAS 1429901-83-6) is a chemical compound with the molecular formula C12H13FN2 and a molecular weight of 204.24 g/mol. IUPAC name: 6-fluoro-2,3,4,9-tetrahydro-1H-carbazol-1-amine. InChIKey: JNAQAPNLBDHNMO-UHFFFAOYSA-N.
| Molecular formula | C12H13FN2 |
|---|---|
| Molecular weight | 204.24 g/mol |
| IUPAC name | 6-fluoro-2,3,4,9-tetrahydro-1H-carbazol-1-amine |
| InChIKey | JNAQAPNLBDHNMO-UHFFFAOYSA-N |
| SMILES | C1CC(C2=C(C1)C3=C(N2)C=CC(=C3)F)N |
Computed by PubChem (NCBI)