Products 505080-54-6
CAS 505080-54-6 is the registry number for 3-Fluoro-4-(piperidin-1-yl)benzonitrile, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 10g, 25g, 5g.
3-fluoro-4-piperidin-1-ylbenzonitrile (CAS 505080-54-6) is a chemical compound with the molecular formula C12H13FN2 and a molecular weight of 204.24 g/mol. IUPAC name: 3-fluoro-4-piperidin-1-ylbenzonitrile. InChIKey: ATWAMCJDNQDOEA-UHFFFAOYSA-N.
| Molecular formula | C12H13FN2 |
|---|---|
| Molecular weight | 204.24 g/mol |
| IUPAC name | 3-fluoro-4-piperidin-1-ylbenzonitrile |
| InChIKey | ATWAMCJDNQDOEA-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C2=C(C=C(C=C2)C#N)F |
Computed by PubChem (NCBI)