CAS 1375069-26-3 is the registry number for 1-Cyclopentyl-5-fluorobenzimidazole, 96%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
1-cyclopentyl-5-fluorobenzimidazole (CAS 1375069-26-3) is a chemical compound with the molecular formula C12H13FN2 and a molecular weight of 204.24 g/mol. IUPAC name: 1-cyclopentyl-5-fluorobenzimidazole. InChIKey: GNVQYDXJANFRSD-UHFFFAOYSA-N.
| Molecular formula | C12H13FN2 |
|---|---|
| Molecular weight | 204.24 g/mol |
| IUPAC name | 1-cyclopentyl-5-fluorobenzimidazole |
| InChIKey | GNVQYDXJANFRSD-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)N2C=NC3=C2C=CC(=C3)F |
Computed by PubChem (NCBI)