CAS 1095263-80-1 is the registry number for 8-Fluoro-5-methyl-2,3,4,5-tetrahydro-1h-pyrido[4,3-b]indole, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg.
8-fluoro-5-methyl-1,2,3,4-tetrahydropyrido[4,3-b]indole (CAS 1095263-80-1) is a chemical compound with the molecular formula C12H13FN2 and a molecular weight of 204.24 g/mol. IUPAC name: 8-fluoro-5-methyl-1,2,3,4-tetrahydropyrido[4,3-b]indole. InChIKey: ITSCINOQOBTTPE-UHFFFAOYSA-N.
| Molecular formula | C12H13FN2 |
|---|---|
| Molecular weight | 204.24 g/mol |
| IUPAC name | 8-fluoro-5-methyl-1,2,3,4-tetrahydropyrido[4,3-b]indole |
| InChIKey | ITSCINOQOBTTPE-UHFFFAOYSA-N |
| SMILES | CN1C2=C(CNCC2)C3=C1C=CC(=C3)F |
Computed by PubChem (NCBI)