Products 1060984-43-1
CAS 1060984-43-1 is the registry number for N-(Benzo[d]thiazol-2-ylmethyl)thiophene-2-carboxamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(1,3-benzothiazol-2-ylmethyl)thiophene-2-carboxamide (CAS 1060984-43-1) is a chemical compound with the molecular formula C13H10N2OS2 and a molecular weight of 274.4 g/mol. IUPAC name: N-(1,3-benzothiazol-2-ylmethyl)thiophene-2-carboxamide. InChIKey: RXBBXHLVROPFKW-UHFFFAOYSA-N.
| Molecular formula | C13H10N2OS2 |
|---|---|
| Molecular weight | 274.4 g/mol |
| IUPAC name | N-(1,3-benzothiazol-2-ylmethyl)thiophene-2-carboxamide |
| InChIKey | RXBBXHLVROPFKW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(S2)CNC(=O)C3=CC=CS3 |
Computed by PubChem (NCBI)