CAS 849525-05-9 is the registry number for N-(2-Methylbenzo[d]thiazol-6-yl)thiophene-2-carboxamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(2-methyl-1,3-benzothiazol-6-yl)thiophene-2-carboxamide (CAS 849525-05-9) is a chemical compound with the molecular formula C13H10N2OS2 and a molecular weight of 274.4 g/mol. IUPAC name: N-(2-methyl-1,3-benzothiazol-6-yl)thiophene-2-carboxamide. InChIKey: VVZCMIMCJKOCNN-UHFFFAOYSA-N.
| Molecular formula | C13H10N2OS2 |
|---|---|
| Molecular weight | 274.4 g/mol |
| IUPAC name | N-(2-methyl-1,3-benzothiazol-6-yl)thiophene-2-carboxamide |
| InChIKey | VVZCMIMCJKOCNN-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(S1)C=C(C=C2)NC(=O)C3=CC=CS3 |
Computed by PubChem (NCBI)