CAS 892292-63-6 appears in our catalog under these names: 2-(Methyl(phenyl)amino)-4H-thieno[3,2-d][1,3]thiazin-4-one, 95%, 95%, 2-(Methyl(phenyl)amino)-4H-thieno[3,2-d][1,3]thiazin-4-one, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
2-(N-methylanilino)thieno[3,2-d][1,3]thiazin-4-one (CAS 892292-63-6) is a chemical compound with the molecular formula C13H10N2OS2 and a molecular weight of 274.4 g/mol. IUPAC name: 2-(N-methylanilino)thieno[3,2-d][1,3]thiazin-4-one. InChIKey: MESMPGDSDNSESV-UHFFFAOYSA-N.
| Molecular formula | C13H10N2OS2 |
|---|---|
| Molecular weight | 274.4 g/mol |
| IUPAC name | 2-(N-methylanilino)thieno[3,2-d][1,3]thiazin-4-one |
| InChIKey | MESMPGDSDNSESV-UHFFFAOYSA-N |
| SMILES | CN(C1=CC=CC=C1)C2=NC3=C(C(=O)S2)SC=C3 |
Computed by PubChem (NCBI)