Products 775314-28-8
CAS 775314-28-8 is the registry number for 2-(Benzo[d]thiazol-2-ylthio)-1-(1H-pyrrol-2-yl)ethan-1-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(1,3-benzothiazol-2-ylsulfanyl)-1-(1H-pyrrol-2-yl)ethanone (CAS 775314-28-8) is a chemical compound with the molecular formula C13H10N2OS2 and a molecular weight of 274.4 g/mol. IUPAC name: 2-(1,3-benzothiazol-2-ylsulfanyl)-1-(1H-pyrrol-2-yl)ethanone. InChIKey: VXEXEGFAURHLBR-UHFFFAOYSA-N.
| Molecular formula | C13H10N2OS2 |
|---|---|
| Molecular weight | 274.4 g/mol |
| IUPAC name | 2-(1,3-benzothiazol-2-ylsulfanyl)-1-(1H-pyrrol-2-yl)ethanone |
| InChIKey | VXEXEGFAURHLBR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(S2)SCC(=O)C3=CC=CN3 |
Computed by PubChem (NCBI)