CAS 1454371-04-0 is the registry number for 7-(4-Methylphenyl)-2-thioxo-2,3-dihydrothieno[3,2-d]pyrimidin-4(1h)-one, 90%. Offered by: Combi-blocks. Available pack sizes: 100mg.
7-(4-methylphenyl)-2-sulfanylidene-1H-thieno[3,2-d]pyrimidin-4-one (CAS 1454371-04-0) is a chemical compound with the molecular formula C13H10N2OS2 and a molecular weight of 274.4 g/mol. IUPAC name: 7-(4-methylphenyl)-2-sulfanylidene-1H-thieno[3,2-d]pyrimidin-4-one. InChIKey: QZIPQFKTZCVKQP-UHFFFAOYSA-N.
| Molecular formula | C13H10N2OS2 |
|---|---|
| Molecular weight | 274.4 g/mol |
| IUPAC name | 7-(4-methylphenyl)-2-sulfanylidene-1H-thieno[3,2-d]pyrimidin-4-one |
| InChIKey | QZIPQFKTZCVKQP-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CSC3=C2NC(=S)NC3=O |
Computed by PubChem (NCBI)