Products 1061505-36-9
CAS 1061505-36-9 is the registry number for N-Cyclohexyltetrahydrothiophene-3-carboxamide 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-cyclohexyl-1,1-dioxothiolane-3-carboxamide (CAS 1061505-36-9) is a chemical compound with the molecular formula C11H19NO3S and a molecular weight of 245.34 g/mol. IUPAC name: N-cyclohexyl-1,1-dioxothiolane-3-carboxamide. InChIKey: GHHMODKNMGVBAD-UHFFFAOYSA-N.
| Molecular formula | C11H19NO3S |
|---|---|
| Molecular weight | 245.34 g/mol |
| IUPAC name | N-cyclohexyl-1,1-dioxothiolane-3-carboxamide |
| InChIKey | GHHMODKNMGVBAD-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)NC(=O)C2CCS(=O)(=O)C2 |
Computed by PubChem (NCBI)