CAS 86938-12-7 is the registry number for Captopril Ethyl Ester. Offered by: Mikromol. Available pack sizes: unit.
Ethyl (2S)-1-[(2S)-2-methyl-3-sulfanylpropanoyl]pyrrolidine-2-carboxylate (CAS 86938-12-7) is a chemical compound with the molecular formula C11H19NO3S and a molecular weight of 245.34 g/mol. IUPAC name: ethyl (2S)-1-[(2S)-2-methyl-3-sulfanylpropanoyl]pyrrolidine-2-carboxylate. InChIKey: NWMWMMRSHRHWMV-BDAKNGLRSA-N.
| Molecular formula | C11H19NO3S |
|---|---|
| Molecular weight | 245.34 g/mol |
| IUPAC name | ethyl (2S)-1-[(2S)-2-methyl-3-sulfanylpropanoyl]pyrrolidine-2-carboxylate |
| InChIKey | NWMWMMRSHRHWMV-BDAKNGLRSA-N |
| SMILES | CCOC(=O)[C@@H]1CCCN1C(=O)[C@H](C)CS |
Computed by PubChem (NCBI)