CAS 185422-71-3 is the registry number for tert-Butyl (S)-4-formyl-2,2-dimethylthiazolidine-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 4-formyl-2,2-dimethyl-1,3-thiazolidine-3-carboxylate (CAS 185422-71-3) is a chemical compound with the molecular formula C11H19NO3S and a molecular weight of 245.34 g/mol. IUPAC name: tert-butyl 4-formyl-2,2-dimethyl-1,3-thiazolidine-3-carboxylate. InChIKey: PFTJFEGOSYUKCB-UHFFFAOYSA-N.
| Molecular formula | C11H19NO3S |
|---|---|
| Molecular weight | 245.34 g/mol |
| IUPAC name | tert-butyl 4-formyl-2,2-dimethyl-1,3-thiazolidine-3-carboxylate |
| InChIKey | PFTJFEGOSYUKCB-UHFFFAOYSA-N |
| SMILES | CC1(N(C(CS1)C=O)C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)