CAS 1340481-89-1 is the registry number for tert-Butyl 8-hydroxy-5-thia-2-azaspiro[3.4]octane-2-carboxylate 97%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl 8-hydroxy-5-thia-2-azaspiro[3.4]octane-2-carboxylate (CAS 1340481-89-1) is a chemical compound with the molecular formula C11H19NO3S and a molecular weight of 245.34 g/mol. IUPAC name: tert-butyl 8-hydroxy-5-thia-2-azaspiro[3.4]octane-2-carboxylate. InChIKey: RJXLYDGIJVVNOZ-UHFFFAOYSA-N.
| Molecular formula | C11H19NO3S |
|---|---|
| Molecular weight | 245.34 g/mol |
| IUPAC name | tert-butyl 8-hydroxy-5-thia-2-azaspiro[3.4]octane-2-carboxylate |
| InChIKey | RJXLYDGIJVVNOZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)C(CCS2)O |
Computed by PubChem (NCBI)