Products 18804-82-5

CAS 18804-82-5 is the registry number for butan-1-amine 4-methylbenzenesulfonate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Butan-1-amine;4-methylbenzenesulfonic acid (CAS 18804-82-5) is a chemical compound with the molecular formula C11H19NO3S and a molecular weight of 245.34 g/mol. IUPAC name: butan-1-amine;4-methylbenzenesulfonic acid. InChIKey: GWHIYUZQWAEXQS-UHFFFAOYSA-N.

Identity
Molecular formulaC11H19NO3S
Molecular weight245.34 g/mol
IUPAC namebutan-1-amine;4-methylbenzenesulfonic acid
InChIKeyGWHIYUZQWAEXQS-UHFFFAOYSA-N
SMILESCCCCN.CC1=CC=C(C=C1)S(=O)(=O)O

Computed by PubChem (NCBI)