CAS 1061604-41-8 appears in our catalog under these names: Lenalidomide–4–OH, 3-(4-Hydroxy-1-oxo-isoindolin-2-yl)piperidine-2,6-dione, Lenalidomide-4-OH 97%, 3-(4-hydroxy-1-oxo-1,3-dihydroisoindol-2-yl)piperidine-2,6-dione, 98%, 98%, 3-(4-Hydroxy-1-oxoisoindolin-2-yl)piperidine-2,6-dione, 99.62%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, MedChemExpress. Available pack sizes: 100mg, 10g, 5g, 25g, 50g, 100g, 250mg, 1g.
3-(7-hydroxy-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione (CAS 1061604-41-8) is a chemical compound with the molecular formula C13H12N2O4 and a molecular weight of 260.24 g/mol. IUPAC name: 3-(7-hydroxy-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione. InChIKey: HGPRKOYQOBYISD-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O4 |
|---|---|
| Molecular weight | 260.24 g/mol |
| IUPAC name | 3-(7-hydroxy-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione |
| InChIKey | HGPRKOYQOBYISD-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2CC3=C(C2=O)C=CC=C3O |
Computed by PubChem (NCBI)