CAS 1416990-08-3 appears in our catalog under these names: 3-(5-Hydroxy-1-oxoisoindolin-2-yl)piperidine-2,6-dione, 95%, Lenalidomide-OH/ 99.77% (existing batch purity), Lenalidomide–OH, 3-(5-Hydroxy-1-oxo-2,3-dihydro-1H-isoindol-2-yl)piperidine-2,6-dione, Lenalidomide-OH 97%. Offered by: Combi-blocks, TargetMol, GLPBio, Biosynth, Ambeed. Available pack sizes: 5g, 250mg, 1g, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso).
3-(6-hydroxy-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione (CAS 1416990-08-3) is a chemical compound with the molecular formula C13H12N2O4 and a molecular weight of 260.24 g/mol. IUPAC name: 3-(6-hydroxy-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione. InChIKey: JJUMFQGCQAUIFH-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O4 |
|---|---|
| Molecular weight | 260.24 g/mol |
| IUPAC name | 3-(6-hydroxy-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione |
| InChIKey | JJUMFQGCQAUIFH-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2CC3=C(C2=O)C=CC(=C3)O |
Computed by PubChem (NCBI)