CAS 953734-04-8 appears in our catalog under these names: 2-(4-[(5-Methyl-1,2-oxazole-4-)amido]phenyl)acetic acid, 95%, 2-(4-(5-Methylisoxazole-4-carboxamido)phenyl)acetic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 250mg.
2-[4-[(5-methyl-1,2-oxazole-4-carbonyl)amino]phenyl]acetic acid (CAS 953734-04-8) is a chemical compound with the molecular formula C13H12N2O4 and a molecular weight of 260.24 g/mol. IUPAC name: 2-[4-[(5-methyl-1,2-oxazole-4-carbonyl)amino]phenyl]acetic acid. InChIKey: SCKCCWYEZOEARX-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O4 |
|---|---|
| Molecular weight | 260.24 g/mol |
| IUPAC name | 2-[4-[(5-methyl-1,2-oxazole-4-carbonyl)amino]phenyl]acetic acid |
| InChIKey | SCKCCWYEZOEARX-UHFFFAOYSA-N |
| SMILES | CC1=C(C=NO1)C(=O)NC2=CC=C(C=C2)CC(=O)O |
Computed by PubChem (NCBI)