Products 1216231-84-3
CAS 1216231-84-3 appears in our catalog under these names: 6,7-Dimethoxy-1,4-dihydroindeno[1,2-c]pyrazole-3-carboxylic acid, 95%, 6,7-DImethoxy-1,4-dihydroindeno(1,2-c)pyrazole-3-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
6,7-dimethoxy-2,4-dihydroindeno[1,2-c]pyrazole-3-carboxylic acid (CAS 1216231-84-3) is a chemical compound with the molecular formula C13H12N2O4 and a molecular weight of 260.24 g/mol. IUPAC name: 6,7-dimethoxy-2,4-dihydroindeno[1,2-c]pyrazole-3-carboxylic acid. InChIKey: MQMSOHSYWQNWSK-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O4 |
|---|---|
| Molecular weight | 260.24 g/mol |
| IUPAC name | 6,7-dimethoxy-2,4-dihydroindeno[1,2-c]pyrazole-3-carboxylic acid |
| InChIKey | MQMSOHSYWQNWSK-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)CC3=C(NN=C32)C(=O)O)OC |
Computed by PubChem (NCBI)